Products 936249-93-3
CAS 936249-93-3 is the registry number for 1-Bromo-2-(difluoromethoxy)-3,5-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-2-(difluoromethoxy)-3,5-difluorobenzene (CAS 936249-93-3) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 1-bromo-2-(difluoromethoxy)-3,5-difluorobenzene. InChIKey: GNUYUMZDOZCIFV-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 1-bromo-2-(difluoromethoxy)-3,5-difluorobenzene |
| InChIKey | GNUYUMZDOZCIFV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)F)Br)F |
Computed by PubChem (NCBI)