1-Bromo-4-methoxy-2-nitrobenzene, 97%
cas: 5344-78-5 — see every product listed under this CAS number, including other names
1-Bromo-4-methoxy-2-nitrobenzene, 97% (CAS 5344-78-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A179157-5g |
| cas | 5344-78-5 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 298.06 Pln | |
| Ambeed | 500g | 1204.75 Pln | |
| Ambeed | 1kg | 1883.38 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 314.36 Pln | |
| BLDpharm | 500g | 1291.79 Pln | |
| BLDpharm | 1kg | 2024.87 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-4-methoxy-2-nitrobenzene (CAS 5344-78-5) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 1-bromo-4-methoxy-2-nitrobenzene. InChIKey: KCOBIBRGPCFIGF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 1-bromo-4-methoxy-2-nitrobenzene |
| InChIKey | KCOBIBRGPCFIGF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)