CAS 5344-78-5 appears in our catalog under these names: 4–Bromo–3–nitroanisole, 4-Bromo-3-nitroanisole, 96% , 4-Bromo-3-nitroanisole, >96.0%(GC), 1-Bromo-4-methoxy-2-nitrobenzene 97%, 4-BROMO-3-NITROANISOLE, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 5g, 25g, 1000g, 10g, 500g, 1kg.
1-bromo-4-methoxy-2-nitrobenzene (CAS 5344-78-5) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 1-bromo-4-methoxy-2-nitrobenzene. InChIKey: KCOBIBRGPCFIGF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 1-bromo-4-methoxy-2-nitrobenzene |
| InChIKey | KCOBIBRGPCFIGF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)