cas: 1679357-80-2 — see every product listed under this CAS number, including other names
1-Bromo-5-chloro-2-fluoro-3-nitrobenzene, 97% (CAS 1679357-80-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622248-250MG |
| cas | 1679357-80-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 1856.66 Pln | |
| Fluorochem | 10g | 3658.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-5-chloro-2-fluoro-3-nitrobenzene (CAS 1679357-80-2) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-5-chloro-2-fluoro-3-nitrobenzene. InChIKey: XJLAZXFXRUYJNM-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-5-chloro-2-fluoro-3-nitrobenzene |
| InChIKey | XJLAZXFXRUYJNM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Br)Cl |
Computed by PubChem (NCBI)