cas: 1679357-80-2 — see every product listed under this CAS number, including other names
1-Bromo-5-chloro-2-fluoro-3-nitrobenzene, 98%, 98% (CAS 1679357-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ8S-100mg |
| cas | 1679357-80-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4197.20 Pln | |
| Chemat | 50g | 6266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-5-chloro-2-fluoro-3-nitrobenzene (CAS 1679357-80-2) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-5-chloro-2-fluoro-3-nitrobenzene. InChIKey: XJLAZXFXRUYJNM-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-5-chloro-2-fluoro-3-nitrobenzene |
| InChIKey | XJLAZXFXRUYJNM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Br)Cl |
Computed by PubChem (NCBI)