cas: 1187385-70-1 — see every product listed under this CAS number, including other names
1-Bromo-5-fluoro-4-iodo-2-nitrobenzene, 98%, 98% (CAS 1187385-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E60-100mg |
| cas | 1187385-70-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 25g | 1720.40 Pln | |
| Chemat | 10g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-5-fluoro-4-iodo-2-nitrobenzene (CAS 1187385-70-1) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 1-bromo-5-fluoro-4-iodo-2-nitrobenzene. InChIKey: CCIQHIQHQUTIAC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 1-bromo-5-fluoro-4-iodo-2-nitrobenzene |
| InChIKey | CCIQHIQHQUTIAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)