cas: 1345471-69-3 — see every product listed under this CAS number, including other names
1-Bromo-5-fluoro-4-methyl-2-nitrobenzene, 97% (CAS 1345471-69-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F095103-1G |
| cas | 1345471-69-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 976.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-5-fluoro-4-methyl-2-nitrobenzene (CAS 1345471-69-3) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 1-bromo-5-fluoro-4-methyl-2-nitrobenzene. InChIKey: TVQLPBXVLOYFQS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 1-bromo-5-fluoro-4-methyl-2-nitrobenzene |
| InChIKey | TVQLPBXVLOYFQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)