cas: 1345471-69-3 — see every product listed under this CAS number, including other names
1-bromo-5-fluoro-4-methyl-2-nitrobenzene, 97%, 97% (CAS 1345471-69-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ZXS-1g |
| cas | 1345471-69-3 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 784.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-5-fluoro-4-methyl-2-nitrobenzene (CAS 1345471-69-3) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 1-bromo-5-fluoro-4-methyl-2-nitrobenzene. InChIKey: TVQLPBXVLOYFQS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 1-bromo-5-fluoro-4-methyl-2-nitrobenzene |
| InChIKey | TVQLPBXVLOYFQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)