Products 56358-46-4
CAS 56358-46-4 appears in our catalog under these names: 6-(Bromomethyl)-2-naphthonitrile 95%, 6-(Bromomethyl)-2-naphthonitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-(bromomethyl)naphthalene-2-carbonitrile (CAS 56358-46-4) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 6-(bromomethyl)naphthalene-2-carbonitrile. InChIKey: ORUYTMCMDRSBEU-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 6-(bromomethyl)naphthalene-2-carbonitrile |
| InChIKey | ORUYTMCMDRSBEU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C#N)C=C1CBr |
Computed by PubChem (NCBI)