Products 52211-22-0
CAS 52211-22-0 appears in our catalog under these names: 1-(Bromomethyl)naphthalene-2-carbonitrile 95%, 1-(Bromomethyl)naphthalene-2-carbonitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-(bromomethyl)naphthalene-2-carbonitrile (CAS 52211-22-0) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 1-(bromomethyl)naphthalene-2-carbonitrile. InChIKey: HWZNRWJRZUNTLO-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 1-(bromomethyl)naphthalene-2-carbonitrile |
| InChIKey | HWZNRWJRZUNTLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2CBr)C#N |
Computed by PubChem (NCBI)