cas: 39273-39-7 — see every product listed under this CAS number, including other names
1-Butylbenzo[cd]indol-2(1H)-one, 95%, 95% (CAS 39273-39-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KL5C-1g |
| cas | 39273-39-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 100g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-butylbenzo[cd]indol-2-one (CAS 39273-39-7) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 1-butylbenzo[cd]indol-2-one. InChIKey: ZSBAMLODXHIFFD-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 1-butylbenzo[cd]indol-2-one |
| InChIKey | ZSBAMLODXHIFFD-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=CC=CC3=C2C(=CC=C3)C1=O |
Computed by PubChem (NCBI)