cas: 39273-39-7 — see every product listed under this CAS number, including other names
2-Butyl-2-azatricyclo[6.3.1.0,4,12]dodeca-1(12),4,6,8,10-pentaen-3-one, 95% (CAS 39273-39-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F647162-1G |
| cas | 39273-39-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 10g | 763.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-butylbenzo[cd]indol-2-one (CAS 39273-39-7) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 1-butylbenzo[cd]indol-2-one. InChIKey: ZSBAMLODXHIFFD-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 1-butylbenzo[cd]indol-2-one |
| InChIKey | ZSBAMLODXHIFFD-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=CC=CC3=C2C(=CC=C3)C1=O |
Computed by PubChem (NCBI)