cas: 315717-76-1 — see every product listed under this CAS number, including other names
1-Cbz-3-Aminomethylpiperidine 97% (CAS 315717-76-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A291035-1g |
| cas | 315717-76-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 765.31 Pln | |
| Ambeed | 10g | 1299.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A291035 |
Benzyl 3-(aminomethyl)piperidine-1-carboxylate (CAS 315717-76-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 3-(aminomethyl)piperidine-1-carboxylate. InChIKey: PAIJQGYSIGOWOF-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | PAIJQGYSIGOWOF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)