cas: 315717-76-1 — see every product listed under this CAS number, including other names
3-Aminomethyl-1-N-Cbz-piperidine, 97% (CAS 315717-76-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011401-500MG |
| cas | 315717-76-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 372.80 Pln | |
| Fluorochem | 25g | 4902.46 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1486.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 3-(aminomethyl)piperidine-1-carboxylate (CAS 315717-76-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 3-(aminomethyl)piperidine-1-carboxylate. InChIKey: PAIJQGYSIGOWOF-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | PAIJQGYSIGOWOF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)