cas: 1602501-66-5 — see every product listed under this CAS number, including other names
1-Chloro-6,7-difluoroisoquinoline, 98% (CAS 1602501-66-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A870398-5g |
| cas | 1602501-66-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18284.98 Pln | |
| AmBeed | 1g | 6358.66 Pln | |
| Fluorochem | 100mg | 1476.58 Pln | |
| Fluorochem | 250mg | 2070.12 Pln | |
| Fluorochem | 1g | 4090.24 Pln | |
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 1g | 2925.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-chloro-6,7-difluoroisoquinoline (CAS 1602501-66-5) is a chemical compound with the molecular formula C9H4ClF2N and a molecular weight of 199.58 g/mol. IUPAC name: 1-chloro-6,7-difluoroisoquinoline. InChIKey: IHICZXCSZNKBFE-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF2N |
|---|---|
| Molecular weight | 199.58 g/mol |
| IUPAC name | 1-chloro-6,7-difluoroisoquinoline |
| InChIKey | IHICZXCSZNKBFE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=CC(=C(C=C21)F)F)Cl |
Computed by PubChem (NCBI)