Products 1094390-29-0
CAS 1094390-29-0 appears in our catalog under these names: 3-Chloro-3-(2,4-difluorophenyl)prop-2-enenitrile, 95%, 3-Chloro-3-(2,4-difluorophenyl)prop-2-enenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(Z)-3-chloro-3-(2,4-difluorophenyl)prop-2-enenitrile (CAS 1094390-29-0) is a chemical compound with the molecular formula C9H4ClF2N and a molecular weight of 199.58 g/mol. IUPAC name: (Z)-3-chloro-3-(2,4-difluorophenyl)prop-2-enenitrile. InChIKey: BLPVGCNZBHHJJD-BAQGIRSFSA-N.
| Molecular formula | C9H4ClF2N |
|---|---|
| Molecular weight | 199.58 g/mol |
| IUPAC name | (Z)-3-chloro-3-(2,4-difluorophenyl)prop-2-enenitrile |
| InChIKey | BLPVGCNZBHHJJD-BAQGIRSFSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C(=C/C#N)/Cl |
Computed by PubChem (NCBI)