CAS 1189105-64-3 appears in our catalog under these names: 4-Chloro-7,8-difluoroquinoline, 95%, 4-Chloro-7,8-difluoroquinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-chloro-7,8-difluoroquinoline (CAS 1189105-64-3) is a chemical compound with the molecular formula C9H4ClF2N and a molecular weight of 199.58 g/mol. IUPAC name: 4-chloro-7,8-difluoroquinoline. InChIKey: JFSJHYFLFHBTQL-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF2N |
|---|---|
| Molecular weight | 199.58 g/mol |
| IUPAC name | 4-chloro-7,8-difluoroquinoline |
| InChIKey | JFSJHYFLFHBTQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)Cl)F)F |
Computed by PubChem (NCBI)