CAS 1251921-78-4 is the registry number for 2-Chloro-4,6-difluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4,6-difluoroquinoline (CAS 1251921-78-4) is a chemical compound with the molecular formula C9H4ClF2N and a molecular weight of 199.58 g/mol. IUPAC name: 2-chloro-4,6-difluoroquinoline. InChIKey: LZJPCHYZVJCZHY-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF2N |
|---|---|
| Molecular weight | 199.58 g/mol |
| IUPAC name | 2-chloro-4,6-difluoroquinoline |
| InChIKey | LZJPCHYZVJCZHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CC(=N2)Cl)F |
Computed by PubChem (NCBI)