1-Chloro-6,7-dimethoxyisoquinoline, 97%
cas: 21560-29-2 — see every product listed under this CAS number, including other names
1-Chloro-6,7-dimethoxyisoquinoline, 97% (CAS 21560-29-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A230597-250mg |
| cas | 21560-29-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2495.25 Pln | |
| Ambeed | 10g | 4186.25 Pln | |
| Ambeed | 25g | 8296.94 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 864.16 Pln | |
| BLDpharm | 5g | 2685.75 Pln | |
| BLDpharm | 10g | 4507.33 Pln | |
| BLDpharm | 25g | 8944.65 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-chloro-6,7-dimethoxyisoquinoline (CAS 21560-29-2) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 1-chloro-6,7-dimethoxyisoquinoline. InChIKey: MPMDYPSDYGHVBM-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 1-chloro-6,7-dimethoxyisoquinoline |
| InChIKey | MPMDYPSDYGHVBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN=C2Cl)OC |
Computed by PubChem (NCBI)