CAS 1216202-07-1 is the registry number for 1-Chloro-5,7-dimethoxyisoquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-chloro-5,7-dimethoxyisoquinoline (CAS 1216202-07-1) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 1-chloro-5,7-dimethoxyisoquinoline. InChIKey: YBGITNZIHLQWBX-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 1-chloro-5,7-dimethoxyisoquinoline |
| InChIKey | YBGITNZIHLQWBX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2Cl)C(=C1)OC |
Computed by PubChem (NCBI)