CAS 21560-29-2 appears in our catalog under these names: 1-Chloro-6,7-dimethoxyisoquinoline, 95%, 1–Chloro–6,7–dimethoxyisoquinoline, 1-chloro-6,7-dimethoxyisoquinoline, 97%, 97%, 1-Chloro-6,7-dimethoxyisoquinoline, 98%, 1-Chloro-6,7-dimethoxyisoquinoline, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 25g, 100mg, 5g, 10g, 50mg, 500mg.
1-chloro-6,7-dimethoxyisoquinoline (CAS 21560-29-2) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 1-chloro-6,7-dimethoxyisoquinoline. InChIKey: MPMDYPSDYGHVBM-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 1-chloro-6,7-dimethoxyisoquinoline |
| InChIKey | MPMDYPSDYGHVBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN=C2Cl)OC |
Computed by PubChem (NCBI)