CAS 68236-22-6 appears in our catalog under these names: 2-Chloro-6,7-dimethoxyquinoline, 95%, 2–Chloro–6,7–dimethoxyquinoline, 2-chloro-6,7-dimethoxyquinoline. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-6,7-dimethoxyquinoline (CAS 68236-22-6) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 2-chloro-6,7-dimethoxyquinoline. InChIKey: UJSZVZXINMWJKC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxyquinoline |
| InChIKey | UJSZVZXINMWJKC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CC(=N2)Cl)OC |
Computed by PubChem (NCBI)