1-Chloroisoquinolin-4-ol, 95%
cas: 3336-43-4 — see every product listed under this CAS number, including other names
1-Chloroisoquinolin-4-ol, 95% (CAS 3336-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A470882-100mg |
| cas | 3336-43-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 1g | 1238.12 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1240.40 Pln | |
| Chemat | 5g | 3587.60 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1330.67 Pln | |
| BLDpharm | 5g | 3846.45 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-chloroisoquinolin-4-ol (CAS 3336-43-4) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 1-chloroisoquinolin-4-ol. InChIKey: JEVLGPVFFYUBRI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 1-chloroisoquinolin-4-ol |
| InChIKey | JEVLGPVFFYUBRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)O |
Computed by PubChem (NCBI)