CAS 64165-35-1 is the registry number for 5-Chloroquinolin-6-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
5-chloroquinolin-6-ol (CAS 64165-35-1) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 5-chloroquinolin-6-ol. InChIKey: UEKMSHRIEDVXED-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-chloroquinolin-6-ol |
| InChIKey | UEKMSHRIEDVXED-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2Cl)O)N=C1 |
Computed by PubChem (NCBI)