CAS 1956384-89-6 appears in our catalog under these names: 4-Chloroisoquinolin-5-ol, 95%, 4-chloroisoquinolin-5-ol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-chloroisoquinolin-5-ol (CAS 1956384-89-6) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 4-chloroisoquinolin-5-ol. InChIKey: FIWLPLYJHZKYEO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 4-chloroisoquinolin-5-ol |
| InChIKey | FIWLPLYJHZKYEO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)O)Cl |
Computed by PubChem (NCBI)