CAS 1261454-55-0 appears in our catalog under these names: 7-Chloroquinolin-3-ol, 95%, 7-Chloroquinolin-3-ol, 7-chloroquinolin-3-ol, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg.
7-chloroquinolin-3-ol (CAS 1261454-55-0) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloroquinolin-3-ol. InChIKey: KFCUFKFKVHHCGF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloroquinolin-3-ol |
| InChIKey | KFCUFKFKVHHCGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)O)Cl |
Computed by PubChem (NCBI)