cas: 1233526-60-7 — see every product listed under this CAS number, including other names
1-Cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1233526-60-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KFE-500mg |
| cas | 1233526-60-7 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 136.40 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 592.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1233526-60-7) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 1-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: OCBNABJVDPSMQY-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 1-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | OCBNABJVDPSMQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CCCC3 |
Computed by PubChem (NCBI)