CAS 2813871-79-1 is the registry number for 3-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 2813871-79-1) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: BBWRGONWSMEHPO-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | BBWRGONWSMEHPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)C(C)C |
Computed by PubChem (NCBI)