Products 60651-49-2
CAS 60651-49-2 appears in our catalog under these names: 3-cyclopropyl-3-hydroxy-1-(pyridin-3-yl)prop-2-en-1-one, 98%, 1-Cyclopropyl-3-(pyridin-3-yl)propane-1,3-dione, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-cyclopropyl-3-pyridin-3-ylpropane-1,3-dione (CAS 60651-49-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-cyclopropyl-3-pyridin-3-ylpropane-1,3-dione. InChIKey: XOBGJHRPKJJPDQ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-cyclopropyl-3-pyridin-3-ylpropane-1,3-dione |
| InChIKey | XOBGJHRPKJJPDQ-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)CC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)