CAS 146257-39-8 appears in our catalog under these names: methyl 3-(1-cyanoethyl)benzoate, 95%, Methyl 3-(1-cyanoethyl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-(1-cyanoethyl)benzoate (CAS 146257-39-8) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 3-(1-cyanoethyl)benzoate. InChIKey: VMRCDTRPKXLHOY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl 3-(1-cyanoethyl)benzoate |
| InChIKey | VMRCDTRPKXLHOY-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)