CAS 304-17-6 appears in our catalog under these names: N-Isopropylphthalimide, 95%, Isopropylphthalimide/ 99.94% (existing batch purity), N–Isopropylphthalimide, N-Isopropylphthalimide, >98.0%(GC), 2-Isopropylisoindoline-1,3-dione, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 1mg, 2mg, 5mg, 10mg.
2-propan-2-ylisoindole-1,3-dione (CAS 304-17-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-propan-2-ylisoindole-1,3-dione. InChIKey: VPLDXHDOGVIETL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-propan-2-ylisoindole-1,3-dione |
| InChIKey | VPLDXHDOGVIETL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)