Products 50614-84-1
CAS 50614-84-1 appears in our catalog under these names: Ethyl indole-4-carboxylate, 98%, Ethyl 1H-indole-4-carboxylate, 98%, Ethyl indole-4-carboxylate, Ethyl indole-4-carboxylate, 98%, 98%, Ethyl 1H-indole-4-carboxylate, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 250g, 250mg.
Ethyl 1H-indole-4-carboxylate (CAS 50614-84-1) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: ethyl 1H-indole-4-carboxylate. InChIKey: ZIUDZKABRXGZFO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | ethyl 1H-indole-4-carboxylate |
| InChIKey | ZIUDZKABRXGZFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=CNC2=CC=C1 |
Computed by PubChem (NCBI)