cas: 1596367-55-3 — see every product listed under this CAS number, including other names
1-Cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one, 98% (CAS 1596367-55-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696487-50MG |
| cas | 1596367-55-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1065.27 Pln | |
| Fluorochem | 100mg | 1856.66 Pln | |
| Fluorochem | 250mg | 3111.42 Pln | |
| Fluorochem | 1g | 7974.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (CAS 1596367-55-3) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one. InChIKey: PSQKCGSTAZGHCJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| InChIKey | PSQKCGSTAZGHCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=O)C=C2)C3CC3 |
Computed by PubChem (NCBI)