Products 1072945-73-3

CAS 1072945-73-3 is the registry number for 3-(Cyclohexyl(methyl)carbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid (CAS 1072945-73-3) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: [3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid. InChIKey: MFWBKTUXYRRWCS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20BNO3
Molecular weight261.13 g/mol
IUPAC name[3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid
InChIKeyMFWBKTUXYRRWCS-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)N(C)C2CCCCC2)(O)O

Computed by PubChem (NCBI)