Products 1072945-73-3
CAS 1072945-73-3 appears in our catalog under these names: 3-(Cyclohexyl(methyl)carbamoyl)phenylboronic acid, 98%, (3-(Cyclohexyl(methyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
[3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid (CAS 1072945-73-3) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: [3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid. InChIKey: MFWBKTUXYRRWCS-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | [3-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | MFWBKTUXYRRWCS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(C)C2CCCCC2)(O)O |
Computed by PubChem (NCBI)