CAS 1197171-76-8 appears in our catalog under these names: 3-(N-Methylaminocarbonyl)phenylboronic acid, pinacol ester, 96%, 3-(N-Methylaminocarbonyl)phenylboronic acid, pinacol ester, 95-<97%, 3-(N-Methylaminocarbonyl)phenylboronic acid, pinacol ester, ≥97-<99%, N–Methyl–3–(tetramethyl–1,3,2– dioxaborolan–2–yl)benzamide, N-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 200g, 300g.
N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1197171-76-8) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: YKVCWFPOJAXHGE-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | YKVCWFPOJAXHGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NC |
Computed by PubChem (NCBI)