Products 1218789-98-0

CAS 1218789-98-0 is the registry number for 2-(Aminocarbonylmethyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1218789-98-0) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: CPFGCHYGAVWSDA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20BNO3
Molecular weight261.13 g/mol
IUPAC name2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide
InChIKeyCPFGCHYGAVWSDA-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CC(=O)N

Computed by PubChem (NCBI)