cas: 93107-30-3 — see every product listed under this CAS number, including other names
1-Cyclopropyl-6,7-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid 98% (CAS 93107-30-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218770-250mg |
| cas | 93107-30-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 620.69 Pln | |
| Ambeed | 100g | 2111.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218770 |
1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid (CAS 93107-30-3) is a chemical compound with the molecular formula C13H9F2NO3 and a molecular weight of 265.21 g/mol. IUPAC name: 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: KNEXGVPHPGXAGF-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO3 |
|---|---|
| Molecular weight | 265.21 g/mol |
| IUPAC name | 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | KNEXGVPHPGXAGF-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)F)F)C(=O)O |
Computed by PubChem (NCBI)