Products 242797-29-1

CAS 242797-29-1 is the registry number for 1-(3,4-Difluorobenzyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid (CAS 242797-29-1) is a chemical compound with the molecular formula C13H9F2NO3 and a molecular weight of 265.21 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid. InChIKey: OQDASTILPYZJIH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9F2NO3
Molecular weight265.21 g/mol
IUPAC name1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid
InChIKeyOQDASTILPYZJIH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CN2C=C(C=CC2=O)C(=O)O)F)F

Computed by PubChem (NCBI)