CAS 1001413-01-9 appears in our catalog under these names: 1-(3,4-Difluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%, 1-(3,4-Difluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid (CAS 1001413-01-9) is a chemical compound with the molecular formula C13H9F2NO3 and a molecular weight of 265.21 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid. InChIKey: CQQJYSYNXKUWPX-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO3 |
|---|---|
| Molecular weight | 265.21 g/mol |
| IUPAC name | 1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid |
| InChIKey | CQQJYSYNXKUWPX-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)C(=O)O)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)