Products 1210419-36-5
CAS 1210419-36-5 is the registry number for Methyl 6-(2,6-difluoro-3-hydroxyphenyl)picolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-(2,6-difluoro-3-hydroxyphenyl)pyridine-2-carboxylate (CAS 1210419-36-5) is a chemical compound with the molecular formula C13H9F2NO3 and a molecular weight of 265.21 g/mol. IUPAC name: methyl 6-(2,6-difluoro-3-hydroxyphenyl)pyridine-2-carboxylate. InChIKey: SLBOTLUDNAZFQG-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO3 |
|---|---|
| Molecular weight | 265.21 g/mol |
| IUPAC name | methyl 6-(2,6-difluoro-3-hydroxyphenyl)pyridine-2-carboxylate |
| InChIKey | SLBOTLUDNAZFQG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=N1)C2=C(C=CC(=C2F)O)F |
Computed by PubChem (NCBI)