cas: 73465-43-7 — see every product listed under this CAS number, including other names
1-Deoxymannojirimycin (hydrochloride), 99.85% (CAS 73465-43-7) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10 mg, 100 mg, 25 mg, 50 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009783-5 mg |
| cas | 73465-43-7 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 505.45 Pln | |
| MedChemExpress | 10 mg | 719.08 Pln | |
| MedChemExpress | 100 mg | 3045.72 Pln | |
| MedChemExpress | 25 mg | 1271.71 Pln | |
| MedChemExpress | 50 mg | 1968.31 Pln | |
| MedChemExpress | 10mM/1mL | 542.60 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.85% |
(2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 73465-43-7) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: ZJIHMALTJRDNQI-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | ZJIHMALTJRDNQI-MVNLRXSJSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O.Cl |
Computed by PubChem (NCBI)