cas: 73465-43-7 — see every product listed under this CAS number, including other names
1-Deoxymannojirimycin hydrochloride (CAS 73465-43-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: TargetMol, Sigma-Aldrich.
| brand | TargetMol |
|---|---|
| catalog number | T22468-1mg |
| cas | 73465-43-7 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 624.84 Pln | |
| TargetMol | 5mg | 1521.48 Pln | |
| TargetMol | 10mg | 2185.57 Pln | |
| TargetMol | 25mg | 3507.04 Pln | |
| Sigma-Aldrich | 10MG | 3350.00 Pln | |
| Sigma-Aldrich | 5MG | 1720.00 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
(2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 73465-43-7) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: ZJIHMALTJRDNQI-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | ZJIHMALTJRDNQI-MVNLRXSJSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O.Cl |
Computed by PubChem (NCBI)