cas: 34993-56-1 — see every product listed under this CAS number, including other names
1-ETHYNYLPYRENE, 95% (CAS 34993-56-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532638-1G |
| cas | 34993-56-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 2.5g | 695.61 Pln | |
| Fluorochem | 5g | 1263.11 Pln | |
| Fluorochem | 10g | 2471.02 Pln | |
| Fluorochem | 25g | 6089.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-ethynylpyrene (CAS 34993-56-1) is a chemical compound with the molecular formula C18H10 and a molecular weight of 226.3 g/mol. IUPAC name: 1-ethynylpyrene. InChIKey: VEBUBSLYGRMOSZ-UHFFFAOYSA-N.
| Molecular formula | C18H10 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 1-ethynylpyrene |
| InChIKey | VEBUBSLYGRMOSZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC3=CC=CC4=C3C2=C(C=C4)C=C1 |
Computed by PubChem (NCBI)