cas: 34993-56-1 — see every product listed under this CAS number, including other names
1-Ethynylpyrene, >98.0%(GC) (CAS 34993-56-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E0939-200MG |
| cas | 34993-56-1 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 895.27 Pln | |
| TCI | 1g | 3501.41 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-ethynylpyrene (CAS 34993-56-1) is a chemical compound with the molecular formula C18H10 and a molecular weight of 226.3 g/mol. IUPAC name: 1-ethynylpyrene. InChIKey: VEBUBSLYGRMOSZ-UHFFFAOYSA-N.
| Molecular formula | C18H10 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 1-ethynylpyrene |
| InChIKey | VEBUBSLYGRMOSZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC3=CC=CC4=C3C2=C(C=C4)C=C1 |
Computed by PubChem (NCBI)