cas: 103863-04-3 — see every product listed under this CAS number, including other names
1-Ethoxy-4-nitroisoquinoline 98% (CAS 103863-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106996-100mg |
| cas | 103863-04-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A106996 |
1-ethoxy-4-nitroisoquinoline (CAS 103863-04-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 1-ethoxy-4-nitroisoquinoline. InChIKey: ALSLVLBKRHXPGR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-ethoxy-4-nitroisoquinoline |
| InChIKey | ALSLVLBKRHXPGR-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C2=CC=CC=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)