CAS 341953-72-8 is the registry number for N-(1,3-Benzodioxol-5-ylmethyl)-2-cyanoacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoacetamide (CAS 341953-72-8) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoacetamide. InChIKey: PUFRJEPXMFFFFK-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoacetamide |
| InChIKey | PUFRJEPXMFFFFK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)CC#N |
Computed by PubChem (NCBI)