Products 2138288-29-4
CAS 2138288-29-4 is the registry number for 2-Cyclopropyl-6-nitro-3H-isoindol-1-one, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-cyclopropyl-6-nitro-3H-isoindol-1-one (CAS 2138288-29-4) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 2-cyclopropyl-6-nitro-3H-isoindol-1-one. InChIKey: UVDYYIQYYRJJBT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 2-cyclopropyl-6-nitro-3H-isoindol-1-one |
| InChIKey | UVDYYIQYYRJJBT-UHFFFAOYSA-N |
| SMILES | C1CC1N2CC3=C(C2=O)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)