CAS 618383-46-3 appears in our catalog under these names: 5-(4-Methoxyphenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Methoxyphenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Methoxy-phenyl)-1H-pyrazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.
5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid (CAS 618383-46-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: YNHHGNUVCCLFDC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | YNHHGNUVCCLFDC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=NN2)C(=O)O |
Computed by PubChem (NCBI)