cas: 1089282-52-9 — see every product listed under this CAS number, including other names
1-Ethyl-2-fluoro-4-methoxy-5-nitrobenzene 98% (CAS 1089282-52-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A989398-100mg |
| cas | 1089282-52-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1382.75 Pln | |
| Ambeed | 5g | 4375.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A989398 |
1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene (CAS 1089282-52-9) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: 1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene. InChIKey: PKSQQMMVEVQWDK-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene |
| InChIKey | PKSQQMMVEVQWDK-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1F)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)