cas: 331717-63-6 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium Thiocyanate, >98.0%(HPLC)(T) (CAS 331717-63-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E0776-5G |
| cas | 331717-63-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 246.19 Pln | |
| TCI | 25g | 944.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
1-ethyl-3-methylimidazol-3-ium thiocyanate (CAS 331717-63-6) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium thiocyanate. InChIKey: VASPYXGQVWPGAB-UHFFFAOYSA-M.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium thiocyanate |
| InChIKey | VASPYXGQVWPGAB-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C(#N)[S-] |
Computed by PubChem (NCBI)